Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A192 | Purity: >98% |
 | |
| Chemical structure of Rostafuroxin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PST2238 |
|---|---|
| CAS No. | 156722-18-8 |
| Purity | >98% |
| Formula | C23H34O4 |
| Mol Weight | 374.5137 |
| CoA | CoA of Rostafuroxin |
| Smiles: | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@](O)(CC[C@]34O)C3=COC=C3)[C@@]1(C)CC[C@H](O)C2 |
|---|
KEYWORDS: buy Rostafuroxin | Rostafuroxin supplier | purchase | cost | manufacturer | order | distributor | buy 156722-18-8 | 156722-18-8 supplier