Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2312 | Purity: >98% |
 | |
| Chemical structure of RO4987655 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | CH-4987655 |
|---|---|
| CAS No. | 874101-00-5 |
| Purity | >98% |
| Formula | C20H19F3IN3O5 |
| Mol Weight | 565.2816 |
| CoA | CoA of RO4987655 |
| Smiles: | OCCONC(=O)C1=CC(CN2OCCCC2=O)=C(F)C(F)=C1NC1=CC=C(I)C=C1F |
|---|
KEYWORDS: buy RO4987655 | RO4987655 supplier | purchase | cost | manufacturer | order | distributor | buy 874101-00-5 | 874101-00-5 supplier