Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1465 | Purity: >98% |
 | |
| Chemical structure of RO0921 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1446790-62-0 |
|---|---|
| Purity | >98% |
| Formula | C18H25N7O |
| Mol Weight | 355.4374 |
| CoA | CoA of RO0921 |
| Smiles: | CC1=C(C)N=C(NC2=CC(N[C@@H]3CCCC[C@@H]3N)=NN=C2C(N)=O)C=C1 |
|---|
KEYWORDS: buy RO0921 | RO0921 supplier | purchase | cost | manufacturer | order | distributor | buy 1446790-62-0 | 1446790-62-0 supplier