Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3573 | Purity: >98% |
 | |
| Chemical structure of Ro 25-6981 Maleate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1312991-76-6 |
|---|---|
| Purity | >98% |
| Formula | C26H33NO6 |
| Mol Weight | 455.5433 |
| CoA | CoA of Ro 25-6981 Maleate |
| Smiles: | OC1=CC=C([C@H](O)[C@@H](C)CN2CCC(CC3=CC=CC=C3)CC2)C=C1.O=C(O)/C=C\C(O)=O |
|---|
KEYWORDS: buy Ro 25-6981 Maleate | Ro 25-6981 Maleate supplier | purchase | cost | manufacturer | order | distributor | buy 1312991-76-6 | 1312991-76-6 supplier