Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3374 | Purity: >98%HPLC |
 | |
| Chemical structure of Rivaroxaban Impurity |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1424944-35-3 |
|---|---|
| Purity | >98%HPLC |
| Formula | C22H19N3O6 |
| Mol Weight | 421.4028 |
| CoA | CoA of Rivaroxaban Impurity |
| Smiles: | O=C(COCC1)N1C(C=C2)=CC=C2N(C3)C(O[C@@H]3CN(C4=O)C(C5=C4C=CC=C5)=O)=O |
|---|
KEYWORDS: buy Rivaroxaban Impurity | Rivaroxaban Impurity supplier | purchase | cost | manufacturer | order | distributor | buy 1424944-35-3 | 1424944-35-3 supplier