Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A688 | Purity: >98% |
 | |
| Chemical structure of Rimonabant |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 168273-06-1 |
|---|---|
| Purity | >98% |
| Formula | C22H21Cl3N4O |
| Mol Weight | 463.787 |
| CoA | CoA of Rimonabant |
| Smiles: | CC1=C(N(N=C1C(=O)NN1CCCCC1)C1=CC=C(Cl)C=C1Cl)C1=CC=C(Cl)C=C1 |
|---|
KEYWORDS: buy Rimonabant | Rimonabant supplier | purchase | cost | manufacturer | order | distributor | buy 168273-06-1 | 168273-06-1 supplier