Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2149 | Purity: >98% |
 | |
| Chemical structure of Rigosertib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ON-01910 |
|---|---|
| CAS No. | 1225497-78-8 |
| Purity | >98% |
| Formula | C21H24NNaO8S |
| Mol Weight | 473.472 |
| CoA | CoA of Rigosertib |
| Smiles: | [Na+].COC1=CC(OC)=C(\C=C\S(=O)(=O)CC2=CC(NCC([O-])=O)=C(OC)C=C2)C(OC)=C1 |
|---|
KEYWORDS: buy Rigosertib | Rigosertib supplier | purchase | cost | manufacturer | order | distributor | buy 1225497-78-8 | 1225497-78-8 supplier