Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1585 | Purity: >98% |
 | |
| Chemical structure of Ribociclib hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | LEE011 hydrochloride |
|---|---|
| CAS No. | 1211443-80-9 |
| Purity | >98% |
| Formula | C23H31ClN8O |
| Mol Weight | 470.998 |
| CoA | CoA of Ribociclib hydrochloride |
| Smiles: | Cl.CN(C)C(=O)C1=CC2=CN=C(NC3=NC=C(C=C3)N3CCNCC3)N=C2N1C1CCCC1 |
|---|
KEYWORDS: buy Ribociclib hydrochloride | Ribociclib hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1211443-80-9 | 1211443-80-9 supplier