Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1709 | Purity: >98% |
 | |
| Chemical structure of Rhodamine 123 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 62669-70-9 |
|---|---|
| Purity | >98% |
| Formula | C21H17ClN2O3 |
| Mol Weight | 380.824 |
| CoA | CoA of Rhodamine 123 |
| Smiles: | Cl.COC(=O)C1=CC=CC=C1C1=C2C=CC(=N)C=C2OC2=C1C=CC(N)=C2 |
|---|
KEYWORDS: buy Rhodamine 123 | Rhodamine 123 supplier | purchase | cost | manufacturer | order | distributor | buy 62669-70-9 | 62669-70-9 supplier