Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2710 | Purity: >98% |
 | |
| Chemical structure of RGX-104 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 610318-03-1 |
|---|---|
| Purity | >98% |
| Formula | C34H34Cl2F3NO3 |
| Mol Weight | 632.54 |
| CoA | CoA of RGX-104 |
| Smiles: | Cl.C[C@H](CCOC1=CC(CC(O)=O)=CC=C1)N(CC(C1=CC=CC=C1)C1=CC=CC=C1)CC1=CC=CC(=C1Cl)C(F)(F)F |
|---|
KEYWORDS: buy RGX-104 | RGX-104 supplier | purchase | cost | manufacturer | order | distributor | buy 610318-03-1 | 610318-03-1 supplier