Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1644-1 | Purity: >98% |
 | |
| Chemical structure of RGH-188 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Cariprazine |
|---|---|
| CAS No. | 839712-12-8 |
| Purity | >98% |
| Formula | C21H32Cl2N4O |
| Mol Weight | 427.411 |
| CoA | CoA of RGH-188 |
| Smiles: | CN(C)C(=O)NC1CCC(CCN2CCN(CC2)C2=C(Cl)C(Cl)=CC=C2)CC1 |
|---|
KEYWORDS: buy RGH-188 | RGH-188 supplier | purchase | cost | manufacturer | order | distributor | buy 839712-12-8 | 839712-12-8 supplier