Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A229 | Purity: >98% |
 | |
| Chemical structure of RGFP966 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1357389-11-7 |
|---|---|
| Purity | >98% |
| Formula | C21H19FN4O |
| Mol Weight | 362.4002 |
| CoA | CoA of RGFP966 |
| Smiles: | NC1=CC(F)=CC=C1NC(=O)\C=C\C1=CN(C\C=C\C2=CC=CC=C2)N=C1 |
|---|
KEYWORDS: buy RGFP966 | RGFP966 supplier | purchase | cost | manufacturer | order | distributor | buy 1357389-11-7 | 1357389-11-7 supplier