Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2461 | Purity: >98% |
 | |
| Chemical structure of Reparixin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 266359-83-5 |
|---|---|
| Purity | >98% |
| Formula | C14H21NO3S |
| Mol Weight | 283.386 |
| CoA | CoA of Reparixin |
| Smiles: | CC(C)CC1=CC=C(C=C1)[C@@H](C)C(=O)NS(C)(=O)=O |
|---|
KEYWORDS: buy Reparixin | Reparixin supplier | purchase | cost | manufacturer | order | distributor | buy 266359-83-5 | 266359-83-5 supplier