Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13764 | Purity: >98% |
 | |
| Chemical structure of RapiFluor-MS |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | RapiFluor MS |
|---|---|
| CAS No. | 1429047-69-7 |
| Purity | >98% |
| Formula | C21H25N5O5 |
| Mol Weight | 427.4537 |
| CoA | CoA of RapiFluor-MS |
| Smiles: | O=C(ON1C(=O)CCC1=O)NC=2C=CC3=NC(=CC=C3C2)C(=O)NCCN(CC)CC |
|---|
KEYWORDS: buy RapiFluor-MS | RapiFluor-MS supplier | purchase | cost | manufacturer | order | distributor | buy 1429047-69-7 | 1429047-69-7 supplier