Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2147 | Purity: >98% |
 | |
| Chemical structure of Raltegravir |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MK-0518 |
|---|---|
| CAS No. | 518048-05-0 |
| Purity | >98% |
| Formula | C20H21FN6O5 |
| Mol Weight | 444.4163 |
| CoA | CoA of Raltegravir |
| Smiles: | CN1C(=O)C(O)=C(N=C1C(C)(C)NC(=O)C1=NN=C(C)O1)C(=O)NCC1=CC=C(F)C=C1 |
|---|
KEYWORDS: buy Raltegravir | Raltegravir supplier | purchase | cost | manufacturer | order | distributor | buy 518048-05-0 | 518048-05-0 supplier