Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1298 | Purity: >98% |
 | |
| Chemical structure of RAF-709 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1628838-42-5 |
|---|---|
| Purity | >98% |
| Formula | C28H29F3N4O4 |
| Mol Weight | 542.5495 |
| CoA | CoA of RAF-709 |
| Smiles: | CC1=NC=C(NC(=O)C2=CC(=CC=C2)C(F)(F)F)C=C1C1=CC(N2CCOCC2)=C(OC2CCOCC2)N=C1 |
|---|
KEYWORDS: buy RAF-709 | RAF-709 supplier | purchase | cost | manufacturer | order | distributor | buy 1628838-42-5 | 1628838-42-5 supplier