Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3995 | Purity: >98% |
 | |
| Chemical structure of Radotinib Dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 926037-85-6 |
|---|---|
| Purity | >98% |
| Formula | C27H23Cl2F3N8O |
| Mol Weight | 603.426 |
| CoA | CoA of Radotinib Dihydrochloride |
| Smiles: | CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)N3C=C(N=C3)C)NC4=NC=CC(=N4)C5=NC=CN=C5.Cl.Cl |
|---|
KEYWORDS: buy Radotinib Dihydrochloride | Radotinib Dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 926037-85-6 | 926037-85-6 supplier