Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A103-1 | Purity: >98% |
 | |
| Chemical structure of R406 besylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 841290-81-1 |
|---|---|
| Purity | >98% |
| Formula | C28H29FN6O8S |
| Mol Weight | 628.629 |
| CoA | CoA of R406 besylate |
| Smiles: | OS(=O)(=O)C1=CC=CC=C1.COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4)C=C3)=N2)=CC(OC)=C1OC |
|---|
KEYWORDS: buy R406 besylate | R406 besylate supplier | purchase | cost | manufacturer | order | distributor | buy 841290-81-1 | 841290-81-1 supplier