Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3705 | Purity: >98% |
 | |
| Chemical structure of (R)-Zanubrutinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1691249-44-1 |
|---|---|
| Purity | >98% |
| Formula | C27H29N5O3 |
| Mol Weight | 471.5509 |
| CoA | CoA of (R)-Zanubrutinib |
| Smiles: | NC(C1=C2N(N=C1C3=CC=C(OC4=CC=CC=C4)C=C3)[C@@H](C5CCN(C(C=C)=O)CC5)CCN2)=O |
|---|
KEYWORDS: buy (R)-Zanubrutinib | (R)-Zanubrutinib supplier | purchase | cost | manufacturer | order | distributor | buy 1691249-44-1 | 1691249-44-1 supplier