Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A798 | Purity: >98% |
 | |
| Chemical structure of R-112 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 575474-82-7 |
|---|---|
| Purity | >98% |
| Formula | C16H13FN4O2 |
| Mol Weight | 312.2984 |
| CoA | CoA of R-112 |
| Smiles: | OC1=CC=CC(NC2=NC(NC3=CC=CC(O)=C3)=NC=C2F)=C1 |
|---|
KEYWORDS: buy R-112 | R-112 supplier | purchase | cost | manufacturer | order | distributor | buy 575474-82-7 | 575474-82-7 supplier