Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A182 | Purity: >98% |
 | |
| Chemical structure of QNZ |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | EVP4593 |
|---|---|
| CAS No. | 545380-34-5 |
| Purity | >98% |
| Formula | C22H20N4O |
| Mol Weight | 356.4204 |
| CoA | CoA of QNZ |
| Smiles: | NC1=CC2=C(NCCC3=CC=C(OC4=CC=CC=C4)C=C3)N=CN=C2C=C1 |
|---|
KEYWORDS: buy QNZ | QNZ supplier | purchase | cost | manufacturer | order | distributor | buy 545380-34-5 | 545380-34-5 supplier