Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2940 | Purity: >98% |
 | |
| Chemical structure of Pyridoclax |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MR29072 |
|---|---|
| CAS No. | 1651890-44-6 |
| Purity | >98% |
| Formula | C29H22N4 |
| Mol Weight | 426.5118 |
| CoA | CoA of Pyridoclax |
| Smiles: | CC1=C(N=CC(=C1)C1=C(\C=C\C2=CC=CC=C2)C=C(C=N1)C1=CN=CC=C1)C1=CN=CC=C1 |
|---|
KEYWORDS: buy Pyridoclax | Pyridoclax supplier | purchase | cost | manufacturer | order | distributor | buy 1651890-44-6 | 1651890-44-6 supplier