Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1698 | Purity: >98% |
 | |
| Chemical structure of PU-WS13 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1454619-14-7 |
|---|---|
| Purity | >98% |
| Formula | C17H20Cl2N6S |
| Mol Weight | 411.352 |
| CoA | CoA of PU-WS13 |
| Smiles: | CC(C)NCCCN1C(SC2=CC(Cl)=CC(Cl)=C2)=NC2=C1N=CN=C2N |
|---|
KEYWORDS: buy PU-WS13 | PU-WS13 supplier | purchase | cost | manufacturer | order | distributor | buy 1454619-14-7 | 1454619-14-7 supplier