Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3723 | Purity: >98% |
 | |
| Chemical structure of PTI-428 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1953130-87-4 |
|---|---|
| Purity | >98% |
| Formula | C18H18N4O4 |
| Mol Weight | 354.3599 |
| CoA | CoA of PTI-428 |
| Smiles: | O=C(C1=CC(C2=CC=CC=C2)=NO1)N[C@H]3C[C@H](C4=NN=C([C@H](O)C)O4)C3 |
|---|
KEYWORDS: buy PTI-428 | PTI-428 supplier | purchase | cost | manufacturer | order | distributor | buy 1953130-87-4 | 1953130-87-4 supplier