Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1246 | Purity: >98% |
 | |
| Chemical structure of PRX-08066 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 866206-55-5 |
|---|---|
| Purity | >98% |
| Formula | C23H21ClFN5O4S |
| Mol Weight | 517.96 |
| CoA | CoA of PRX-08066 |
| Smiles: | OC(=O)\C=C/C(O)=O.FC1=CC=C(CN2CCC(CC2)NC2=C3C=C(Cl)SC3=NC=N2)C=C1C#N |
|---|
KEYWORDS: buy PRX-08066 | PRX-08066 supplier | purchase | cost | manufacturer | order | distributor | buy 866206-55-5 | 866206-55-5 supplier