Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10682 | Purity: >98% |
 | |
| Chemical structure of Propionyl CoA |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 317-66-8 |
|---|---|
| Purity | >98% |
| Formula | C24H40N7O17P3S |
| Mol Weight | 823.597 |
| CoA | CoA of Propionyl CoA |
| Smiles: | O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(OP(O)(OCC(C)([C@H](C(NCCC(NCCSC(CC)=O)=O)=O)O)C)=O)=O)O[C@H]1N2C3=NC=NC(N)=C3N=C2 |
|---|
KEYWORDS: buy Propionyl CoA | Propionyl CoA supplier | purchase | cost | manufacturer | order | distributor | buy 317-66-8 | 317-66-8 supplier