Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2645 | Purity: >98% |
 | |
| Chemical structure of Prasugrel hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 389574-19-0 |
|---|---|
| Purity | >98% |
| Formula | C20H21ClFNO3S |
| Mol Weight | 409.902 |
| CoA | CoA of Prasugrel hydrochloride |
| Smiles: | Cl.CC(=O)OC1=CC2=C(CCN(C2)C(C(=O)C2CC2)C2=CC=CC=C2F)S1 |
|---|
KEYWORDS: buy Prasugrel hydrochloride | Prasugrel hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 389574-19-0 | 389574-19-0 supplier