Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2141 | Purity: >98% |
 | |
| Chemical structure of PPQ-102 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 931706-15-9 |
|---|---|
| Purity | >98% |
| Formula | C26H22N4O3 |
| Mol Weight | 438.4779 |
| CoA | CoA of PPQ-102 |
| Smiles: | CN1C2=C3C(NC4=CC=CC=C4N3C(=C2C(=O)N(C)C1=O)C1=CC=CC=C1)C1=CC=C(C)O1 |
|---|
KEYWORDS: buy PPQ-102 | PPQ-102 supplier | purchase | cost | manufacturer | order | distributor | buy 931706-15-9 | 931706-15-9 supplier