Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A186 | Purity: >98% |
 | |
| Chemical structure of PLX4720 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 918505-84-7 |
|---|---|
| Purity | >98% |
| Formula | C17H14ClF2N3O3S |
| Mol Weight | 413.826 |
| CoA | CoA of PLX4720 |
| Smiles: | CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C2=CNC3=NC=C(Cl)C=C23)=C1F |
|---|
KEYWORDS: buy PLX4720 | PLX4720 supplier | purchase | cost | manufacturer | order | distributor | buy 918505-84-7 | 918505-84-7 supplier