Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1260 | Purity: >98% |
 | |
| Chemical structure of Pluripotin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 839707-37-8 |
|---|---|
| Purity | >98% |
| Formula | C27H25F3N8O2 |
| Mol Weight | 550.535 |
| CoA | CoA of Pluripotin |
| Smiles: | CN1N=C(C)C=C1NC1=NC=C2CN(C(=O)N(C)C2=N1)C1=CC(NC(=O)C2=CC=CC(=C2)C(F)(F)F)=CC=C1C |
|---|
KEYWORDS: buy Pluripotin | Pluripotin supplier | purchase | cost | manufacturer | order | distributor | buy 839707-37-8 | 839707-37-8 supplier