Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A292 | Purity: >98% |
 | |
| Chemical structure of Plinabulin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | NPI-2358 |
|---|---|
| CAS No. | 714272-27-2 |
| Purity | >98% |
| Formula | C19H20N4O2 |
| Mol Weight | 336.3877 |
| CoA | CoA of Plinabulin |
| Smiles: | CC(C)(C)C1=C(\C=C2/NC(=O)\C(NC2=O)=C\C2=CC=CC=C2)N=CN1 |
|---|
KEYWORDS: buy Plinabulin | Plinabulin supplier | purchase | cost | manufacturer | order | distributor | buy 714272-27-2 | 714272-27-2 supplier