Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1448 | Purity: >98% |
 | |
| Chemical structure of Pleconaril |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | VP 63843 |
|---|---|
| Synonyms 2 | Win 63843 |
| CAS No. | 153168-05-9 |
| Purity | >98% |
| Formula | C18H18F3N3O3 |
| Mol Weight | 381.349 |
| CoA | CoA of Pleconaril |
| Smiles: | CC1=NOC(CCCOC2=C(C)C=C(C=C2C)C2=NOC(=N2)C(F)(F)F)=C1 |
|---|
KEYWORDS: buy Pleconaril | Pleconaril supplier | purchase | cost | manufacturer | order | distributor | buy 153168-05-9 | 153168-05-9 supplier