Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A251 | Purity: >98% |
 | |
| Chemical structure of PJ34 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 344458-15-7 |
|---|---|
| Purity | >98% |
| Formula | C17H18ClN3O2 |
| Mol Weight | 331.797 |
| CoA | CoA of PJ34 |
| Smiles: | Cl.CN(C)CC(=O)NC1=CC=C2NC(=O)C3=C(C=CC=C3)C2=C1 |
|---|
KEYWORDS: buy PJ34 | PJ34 supplier | purchase | cost | manufacturer | order | distributor | buy 344458-15-7 | 344458-15-7 supplier