Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1217 | Purity: >98% |
 | |
| Chemical structure of Piperoxan hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 135-87-5 |
|---|---|
| Purity | >98% |
| Formula | C14H20ClNO2 |
| Mol Weight | 269.767 |
| CoA | CoA of Piperoxan hydrochloride |
| Smiles: | Cl.C(C1COC2=CC=CC=C2O1)N1CCCCC1 |
|---|
KEYWORDS: buy Piperoxan hydrochloride | Piperoxan hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 135-87-5 | 135-87-5 supplier