Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2137 | Purity: >98% |
 | |
| Chemical structure of PIK-93 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 593960-11-3 |
|---|---|
| Purity | >98% |
| Formula | C14H16ClN3O4S2 |
| Mol Weight | 389.878 |
| CoA | CoA of PIK-93 |
| Smiles: | CC(=O)NC1=NC(C)=C(S1)C1=CC=C(Cl)C(=C1)S(=O)(=O)NCCO |
|---|
KEYWORDS: buy PIK-93 | PIK-93 supplier | purchase | cost | manufacturer | order | distributor | buy 593960-11-3 | 593960-11-3 supplier