Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1303A | Purity: >98% |
 | |
| Chemical structure of Pidnarulex HCl |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | CX-5461 HCl |
|---|---|
| Synonyms 2 | CX-5461 hydrochloride |
| CAS No. | 2101314-20-7 |
| Purity | >98% |
| Formula | C27H28ClN7O2S |
| Mol Weight | 550.075 |
| CoA | CoA of Pidnarulex HCl |
| Smiles: | Cl.O=C(NCC=1N=CC(=NC1)C)C=2C(=O)C3=CC=C(N=C3N4C2SC=5C=CC=CC54)N6CCN(C)CCC6 |
|---|
KEYWORDS: buy Pidnarulex HCl | Pidnarulex HCl supplier | purchase | cost | manufacturer | order | distributor | buy 2101314-20-7 | 2101314-20-7 supplier