Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16429D | Purity: >97% |
 | |
| Chemical structure of PhTXPhos |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms 2 | 2,6-bis(2,4,6-triisopropylphenyl)phenyl-diphenylphosphine |
|---|---|
| CAS No. | 2376379-77-8 |
| Purity | >97% |
| Formula | C48H59P |
| Mol Weight | 666.9558 |
| CoA | CoA of PhTXPhos |
| Smiles: | C=1C=CC(=CC1)P(C=2C=CC=CC2)C3=C(C=CC=C3C=4C(=CC(=CC4C(C)C)C(C)C)C(C)C)C5=C(C=C(C=C5C(C)C)C(C)C)C(C)C |
|---|
KEYWORDS: buy PhTXPhos | PhTXPhos supplier | purchase | cost | manufacturer | order | distributor | buy 2376379-77-8 | 2376379-77-8 supplier