Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A5353 | Purity: >98% |
 | |
| Chemical structure of Phen-NaDPO |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1480371-38-7 |
|---|---|
| Purity | >98% |
| Formula | C34H23N2OP |
| Mol Weight | 506.533 |
| CoA | CoA of Phen-NaDPO |
| Smiles: | O=P(C1=CC2=CC=C(C3=CC4=CC=C5C=CC=NC5=C4N=C3)C=C2C=C1)(C6=CC=CC=C6)C7=CC=CC=C7 |
|---|
KEYWORDS: buy Phen-NaDPO | Phen-NaDPO supplier | purchase | cost | manufacturer | order | distributor | buy 1480371-38-7 | 1480371-38-7 supplier