Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2019 | Purity: 0.993 |
 | |
| Chemical structure of PHCCC |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 179068-02-1 |
|---|---|
| Purity | 0.993 |
| Formula | C17H14N2O3 |
| Mol Weight | 294.3047 |
| CoA | CoA of PHCCC |
| Smiles: | O\N=C1/C2CC2(OC2=CC=CC=C12)C(=O)NC1=CC=CC=C1 |
|---|
KEYWORDS: buy PHCCC | PHCCC supplier | purchase | cost | manufacturer | order | distributor | buy 179068-02-1 | 179068-02-1 supplier