Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2344 | Purity: >98% |
 | |
| Chemical structure of PH797804 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 586379-66-0 |
|---|---|
| Purity | >98% |
| Formula | C22H19BrF2N2O3 |
| Mol Weight | 477.299 |
| CoA | CoA of PH797804 |
| Smiles: | CNC(=O)C1=CC=C(C)C(=C1)N1C(C)=CC(OCC2=CC=C(F)C=C2F)=C(Br)C1=O |
|---|
KEYWORDS: buy PH797804 | PH797804 supplier | purchase | cost | manufacturer | order | distributor | buy 586379-66-0 | 586379-66-0 supplier