Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A823 | Purity: >98% |
 | |
| Chemical structure of PFI-4 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 900305-37-5 |
|---|---|
| Purity | >98% |
| Formula | C21H24N4O3 |
| Mol Weight | 380.4403 |
| CoA | CoA of PFI-4 |
| Smiles: | COC1=CC=CC=C1C(=O)NC1=C(C=C2N(C)C(=O)N(C)C2=C1)N1CCCC1 |
|---|
KEYWORDS: buy PFI-4 | PFI-4 supplier | purchase | cost | manufacturer | order | distributor | buy 900305-37-5 | 900305-37-5 supplier