Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A248 | Purity: >98% |
 | |
| Chemical structure of PF4708671 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1255517-76-0 |
|---|---|
| Purity | >98% |
| Formula | C19H21F3N6 |
| Mol Weight | 390.4054 |
| CoA | CoA of PF4708671 |
| Smiles: | CCC1=CN=CN=C1N1CCN(CC2=NC3=CC(=CC=C3N2)C(F)(F)F)CC1 |
|---|
KEYWORDS: buy PF4708671 | PF4708671 supplier | purchase | cost | manufacturer | order | distributor | buy 1255517-76-0 | 1255517-76-0 supplier