Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A560 | Purity: >98% |
 | |
| Chemical structure of PF06447475 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1527473-33-1 |
|---|---|
| Purity | >98% |
| Formula | C17H15N5O |
| Mol Weight | 305.3339 |
| CoA | CoA of PF06447475 |
| Smiles: | N#CC1=CC=CC(=C1)C1=CNC2=NC=NC(N3CCOCC3)=C12 |
|---|
KEYWORDS: buy PF06447475 | PF06447475 supplier | purchase | cost | manufacturer | order | distributor | buy 1527473-33-1 | 1527473-33-1 supplier