Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9447A | Purity: >98% |
 | |
| Chemical structure of PF-794 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PF-06279794 hydrochloride |
|---|---|
| Synonyms 2 | https://pubmed.ncbi.nlm.nih.gov/26722027/ |
| CAS No. | 2101206-58-8 |
| Purity | >98% |
| Formula | C22H21ClN4O |
| Mol Weight | 392.881 |
| Shipping | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| CoA | CoA of PF-794 hydrochloride |
| Smiles: | Cl.CC(C)NC(=O)C1=CC=C(C=C1)C1=CC(=CN=C1N)C1=CC=C(C=C1)C#N |
|---|
KEYWORDS: buy PF-794 hydrochloride | PF-794 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2101206-58-8 | 2101206-58-8 supplier