Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3135 | Purity: >98% |
 | |
| Chemical structure of PF-06747711 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | RORC2 Inverse Agonist |
|---|---|
| CAS No. | 1892576-58-7 |
| Purity | >98% |
| Formula | C26H26F3N5O2 |
| Mol Weight | 497.5121 |
| CoA | CoA of PF-06747711 |
| Smiles: | O=C(NC1=CN=C(N(C)C=C2C3CCN(C(C(C)C)=O)CC3)C2=C1C(F)(F)F)C4=CC=CC(C#N)=C4 |
|---|
KEYWORDS: buy PF-06747711 | PF-06747711 supplier | purchase | cost | manufacturer | order | distributor | buy 1892576-58-7 | 1892576-58-7 supplier