Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2705 | Purity: >98% |
 | |
| Chemical structure of PF-06459988 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1428774-45-1 |
|---|---|
| Purity | >98% |
| Formula | C19H22ClN7O3 |
| Mol Weight | 431.876 |
| CoA | CoA of PF-06459988 |
| Smiles: | CO[C@H]1CN(C[C@@H]1COC1=C2C(Cl)=CNC2=NC(NC2=CN(C)N=C2)=N1)C(=O)C=C |
|---|
KEYWORDS: buy PF-06459988 | PF-06459988 supplier | purchase | cost | manufacturer | order | distributor | buy 1428774-45-1 | 1428774-45-1 supplier