Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2343 | Purity: >98% |
 | |
| Chemical structure of PF-04929113 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | SNX-5422 |
|---|---|
| CAS No. | 908115-27-5 |
| Purity | >98% |
| Formula | C25H30F3N5O4 |
| Mol Weight | 521.532 |
| CoA | CoA of PF-04929113 |
| Smiles: | CC1(C)CC2=C(C(=NN2C2=CC(NC3CCC(CC3)OC(=O)CN)=C(C=C2)C(N)=O)C(F)(F)F)C(=O)C1 |
|---|
KEYWORDS: buy PF-04929113 | PF-04929113 supplier | purchase | cost | manufacturer | order | distributor | buy 908115-27-5 | 908115-27-5 supplier