Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A449 | Purity: >98% |
 | |
| Chemical structure of PF-04217903 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1159490-85-3 |
|---|---|
| Purity | >98% |
| Formula | C25H22N8O5S |
| Mol Weight | 546.558 |
| CoA | CoA of PF-04217903 |
| Smiles: | OC1=CC=C(C=C1)S(O)(=O)=O.OCCN1C=C(C=N1)C1=CN=C2N=NN(CC3=CC=C4N=CC=CC4=C3)C2=N1 |
|---|
KEYWORDS: buy PF-04217903 | PF-04217903 supplier | purchase | cost | manufacturer | order | distributor | buy 1159490-85-3 | 1159490-85-3 supplier