Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2822 | Purity: >98% |
 | |
| Chemical structure of PF-00299804 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Dacomitinib monohydrate |
|---|---|
| CAS No. | 1042385-75-0 |
| Purity | >98% |
| Formula | C24H27ClFN5O3 |
| Mol Weight | 487.954 |
| CoA | CoA of PF-00299804 |
| Smiles: | O.COC1=C(NC(=O)\C=C\CN2CCCCC2)C=C2C(NC3=CC(Cl)=C(F)C=C3)=NC=NC2=C1 |
|---|
KEYWORDS: buy PF-00299804 | PF-00299804 supplier | purchase | cost | manufacturer | order | distributor | buy 1042385-75-0 | 1042385-75-0 supplier