Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12483A | Purity: >98% |
 | |
| Chemical structure of PEP07 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1803106-01-5 |
|---|---|
| Purity | >98% |
| Formula | C21H23ClFN7O |
| Mol Weight | 443.905 |
| CoA | CoA of PEP07 hydrochloride |
| Smiles: | Cl.N#CC1=NC=C(N=C1)NC2=NNC(=C2)C=3C=CC(=CC3OC)C4(F)CCN(C)CC4 |
|---|
KEYWORDS: buy PEP07 hydrochloride | PEP07 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1803106-01-5 | 1803106-01-5 supplier